|
CAS#: 17974-66-2 Product: (3alpha,5beta,7alpha,8xi,9xi,14xi,17xi)-3,7-Dihydroxycholestan-26-oic acid No suppilers available for the product. |
| Name | (3alpha,5beta,7alpha,8xi,9xi,14xi,17xi)-3,7-Dihydroxycholestan-26-oic acid |
|---|---|
| Synonyms | 3α,7α-dihydroxy-5β-cholestan-26-oic acid; 3α,7α-Dihydroxy-5β-cholestanate; 3α,7α-dihydroxy-5β-cholestanic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C27H46O4 |
| Molecular Weight | 434.65 |
| CAS Registry Number | 17974-66-2 |
| SMILES | O=C(O)C(C)CCC[C@H](C1CCC2[C@]1(C)CCC4C2[C@H](O)C[C@@H]3C[C@H](O)CC[C@@]34C)C |
| InChI | 1S/C27H46O4/c1-16(6-5-7-17(2)25(30)31)20-8-9-21-24-22(11-13-27(20,21)4)26(3)12-10-19(28)14-18(26)15-23(24)29/h16-24,28-29H,5-15H2,1-4H3,(H,30,31)/t16-,17?,18+,19-,20?,21?,22?,23-,24?,26+,27-/m1/s1 |
| InChIKey | ITZYGDKGRKKBSN-SQZYAAIWSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 574.184°C at 760 mmHg (Cal.) |
| Flash point | 315.101°C (Cal.) |
| Refractive index | 1.533 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3alpha,5beta,7alpha,8xi,9xi,14xi,17xi)-3,7-Dihydroxycholestan-26-oic acid |