|
CAS#: 17977-13-8 Product: 2,2-Dinitropropyl Methacrylate No suppilers available for the product. |
| Name | 2,2-Dinitropropyl Methacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid 2,2-Dinitropropyl Ester; 2-Methylacrylic Acid 2,2-Dinitropropyl Ester; 2,2-Dinitropropyl Methacrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H10N2O6 |
| Molecular Weight | 218.17 |
| CAS Registry Number | 17977-13-8 |
| EINECS | 241-899-1 |
| SMILES | C(C([N+]([O-])=O)([N+]([O-])=O)C)OC(=O)C(=C)C |
| InChI | 1S/C7H10N2O6/c1-5(2)6(10)15-4-7(3,8(11)12)9(13)14/h1,4H2,2-3H3 |
| InChIKey | QTIMQTTZBLVHIH-UHFFFAOYSA-N |
| Density | 1.298g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.326°C at 760 mmHg (Cal.) |
| Flash point | 145.541°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dinitropropyl Methacrylate |