|
CAS#: 180146-67-2 Product: 1-(Bromomethyl)-3-Nitro-5-(Trifluoromethyl)Benzene No suppilers available for the product. |
| Name | 1-(Bromomethyl)-3-Nitro-5-(Trifluoromethyl)Benzene |
|---|---|
| Synonyms | 3-Nitro-5-(trifluoromethyl)benzyl bromide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5BrF3NO2 |
| Molecular Weight | 284.03 |
| CAS Registry Number | 180146-67-2 |
| SMILES | BrCc1cc(cc(c1)C(F)(F)F)N(=O)=O |
| InChI | 1S/C8H5BrF3NO2/c9-4-5-1-6(8(10,11)12)3-7(2-5)13(14)15/h1-3H,4H2 |
| InChIKey | LQIQSFGFVNXGHW-UHFFFAOYSA-N |
| Density | 1.729g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.372°C at 760 mmHg (Cal.) |
| Flash point | 120.341°C (Cal.) |
| Refractive index | 1.526 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Bromomethyl)-3-Nitro-5-(Trifluoromethyl)Benzene |