|
CAS#: 18030-62-1 Product: o-Trichlorosilylbiphenyl No suppilers available for the product. |
| Name | o-Trichlorosilylbiphenyl |
|---|---|
| Synonyms | O-Trichlorosilylbiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9Cl3Si |
| Molecular Weight | 287.65 |
| CAS Registry Number | 18030-62-1 |
| SMILES | C1=C(C=CC=C1)C2=CC=CC=C2[Si](Cl)(Cl)Cl |
| InChI | 1S/C12H9Cl3Si/c13-16(14,15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| InChIKey | IGRRVYLDRDYVLM-UHFFFAOYSA-N |
| Density | 1.306g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.476°C at 760 mmHg (Cal.) |
| Flash point | 176.507°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for o-Trichlorosilylbiphenyl |