|
CAS#: 180466-98-2 Product: Dimethyl (4-Cyanobenzyl)Phosphonate No suppilers available for the product. |
| Name | Dimethyl (4-Cyanobenzyl)Phosphonate |
|---|---|
| Synonyms | Phosphonic acid, [(4-cyanophenyl)methyl]-, dimethyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12NO3P |
| Molecular Weight | 225.18 |
| CAS Registry Number | 180466-98-2 |
| SMILES | O=P(OC)(OC)Cc1ccc(C#N)cc1 |
| InChI | 1S/C10H12NO3P/c1-13-15(12,14-2)8-10-5-3-9(7-11)4-6-10/h3-6H,8H2,1-2H3 |
| InChIKey | XGBXKFFOFJXZIP-UHFFFAOYSA-N |
| Density | 1.199g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.735°C at 760 mmHg (Cal.) |
| Flash point | 177.41°C (Cal.) |
| Refractive index | 1.502 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl (4-Cyanobenzyl)Phosphonate |