|
CAS#: 18048-87-8 Product: Cysteinylcysteine No suppilers available for the product. |
| Name | Cysteinylcysteine |
|---|---|
| Synonyms | (2R)-2-[[(2R)-2-Amino-3-Sulfanyl-Propanoyl]Amino]-3-Sulfanyl-Propanoic Acid; (2R)-2-[[(2R)-2-Amino-3-Mercapto-1-Oxopropyl]Amino]-3-Mercaptopropanoic Acid; (2R)-2-[[(2R)-2-Amino-3-Mercapto-Propanoyl]Amino]-3-Mercapto-Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12N2O3S2 |
| Molecular Weight | 224.29 |
| CAS Registry Number | 18048-87-8 |
| SMILES | [C@@H](NC(=O)[C@@H](N)CS)(C(=O)O)CS |
| InChI | 1S/C6H12N2O3S2/c7-3(1-12)5(9)8-4(2-13)6(10)11/h3-4,12-13H,1-2,7H2,(H,8,9)(H,10,11)/t3-,4-/m0/s1 |
| InChIKey | OABOXRPGTFRBFZ-IMJSIDKUSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.114°C at 760 mmHg (Cal.) |
| Flash point | 244.165°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cysteinylcysteine |