|
CAS#: 18059-53-5 Product: 1,1'-[2-Butene-1,4-Diylbis(Oxy)]Bis(4-Chlorobenzene) No suppilers available for the product. |
| Name | 1,1'-[2-Butene-1,4-Diylbis(Oxy)]Bis(4-Chlorobenzene) |
|---|---|
| Synonyms | 1,4-BIS-(4-CHLOROPHENOXY)-2-BUTENE |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14Cl2O2 |
| Molecular Weight | 309.19 |
| CAS Registry Number | 18059-53-5 |
| SMILES | c1cc(ccc1OCC=CCOc2ccc(cc2)Cl)Cl |
| InChI | 1S/C16H14Cl2O2/c17-13-3-7-15(8-4-13)19-11-1-2-12-20-16-9-5-14(18)6-10-16/h1-10H,11-12H2 |
| InChIKey | CTLVUWCSVANYOV-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.297°C at 760 mmHg (Cal.) |
| Flash point | 158.058°C (Cal.) |
| Refractive index | 1.581 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[2-Butene-1,4-Diylbis(Oxy)]Bis(4-Chlorobenzene) |