|
CAS#: 18067-31-7 Product: Ethane-1,2-Disulfonic Acid No suppilers available for the product. |
| Name | Ethane-1,2-Disulfonic Acid |
|---|---|
| Synonyms | 5-(Chloromethyl)-4-Methyl-Oxazole; 5-(Chloromethyl)-4-Methyl-Oxazole; Ethane-1,2-Disulfonic Acid; 5-(Chloromethyl)-4-Methyloxazole; 5-(Chloromethyl)-4-Methyloxazole; Ethane-1,2-Disulfonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18Cl2N2O8S2 |
| Molecular Weight | 453.31 |
| CAS Registry Number | 18067-31-7 |
| SMILES | C1=NC(=C(O1)CCl)C.C2=NC(=C(O2)CCl)C.C([S](=O)(=O)O)C[S](=O)(=O)O |
| InChI | 1S/2C5H6ClNO.C2H6O6S2/c2*1-4-5(2-6)8-3-7-4;3-9(4,5)1-2-10(6,7)8/h2*3H,2H2,1H3;1-2H2,(H,3,4,5)(H,6,7,8) |
| InChIKey | UULQYTJKALLOJO-UHFFFAOYSA-N |
| Boiling point | 702.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 378.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethane-1,2-Disulfonic Acid |