| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Chlorotriphenylethylene |
|---|---|
| Synonyms | [2-Chloro-1,2-Di(Phenyl)Vinyl]Benzene; Benzene, 1,1',1''-(1-Chloro-1-Ethenyl-2-Ylidene)Tris-; Ethylene, Chlorotriphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H15Cl |
| Molecular Weight | 290.79 |
| CAS Registry Number | 18084-97-4 |
| EINECS | 241-992-7 |
| SMILES | C3=C(C(C1=CC=CC=C1)=C(C2=CC=CC=C2)Cl)C=CC=C3 |
| InChI | 1S/C20H15Cl/c21-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15H |
| InChIKey | QEQFTTCZLHLKFX-UHFFFAOYSA-N |
| Density | 1.146g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.59°C at 760 mmHg (Cal.) |
| Flash point | 182.079°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | E. Herdtweck, W. Ziche and N. Auner. 1-Chloro-1,2,2-triphenylethene, C20H15Cl, Acta Cryst. (1994). C50, 81-83 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Chlorotriphenylethylene |