|
CAS#: 18096-66-7 Product: 1H-Indene-2-Methanol Acetate No suppilers available for the product. |
| Name | 1H-Indene-2-Methanol Acetate |
|---|---|
| Synonyms | Acetic Acid 1H-Inden-2-Ylmethyl Ester; 1H-Inden-2-Ylmethyl Ethanoate; 1H-Indene-2-Methanol, Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 |
| CAS Registry Number | 18096-66-7 |
| SMILES | C1=CC=CC2=C1C=C(C2)COC(C)=O |
| InChI | 1S/C12H12O2/c1-9(13)14-8-10-6-11-4-2-3-5-12(11)7-10/h2-6H,7-8H2,1H3 |
| InChIKey | STBNCGKRPRXKOJ-UHFFFAOYSA-N |
| Density | 1.125g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.46°C at 760 mmHg (Cal.) |
| Flash point | 133.713°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Indene-2-Methanol Acetate |