|
CAS#: 18107-29-4 Product: 1-Methoxy-1,1,2,2,2-Pentamethyldisilane No suppilers available for the product. |
| Name | 1-Methoxy-1,1,2,2,2-Pentamethyldisilane |
|---|---|
| Synonyms | 1-Methoxy-1,1,2,2,2-pentamethyldisilane #; Dimethyl(trimethylsilyl)methoxysilane |
| Molecular Structure | ![]() |
| Molecular Formula | C6H18OSi2 |
| Molecular Weight | 162.38 |
| CAS Registry Number | 18107-29-4 |
| SMILES | O(C)[Si](C)(C)[Si](C)(C)C |
| InChI | 1S/C6H18OSi2/c1-7-9(5,6)8(2,3)4/h1-6H3 |
| InChIKey | DWZFNULJNZJRLM-UHFFFAOYSA-N |
| Density | 0.791g/cm3 (Cal.) |
|---|---|
| Boiling point | 127.191°C at 760 mmHg (Cal.) |
| Flash point | 20.984°C (Cal.) |
| Refractive index | 1.393 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methoxy-1,1,2,2,2-Pentamethyldisilane |