Online Database of Chemicals from Around the World
|
CAS#: 18122-77-5 Product: 1,1'-(1,2-Dibromoethane-1,2-Diyl)Bis[3,4-Dibromocyclohexane] No suppilers available for the product. |
| Name | 1,1'-(1,2-Dibromoethane-1,2-Diyl)Bis[3,4-Dibromocyclohexane] |
|---|---|
| Synonyms | 1,1'-(1,2-Dibromo-1,2-Ethanediyl)Bis(3,4-Dibromocyclohexane); 1,1'-(1,2-Dibromoethane-1,2-Diyl)Bis(3,4-Dibromocyclohexane); Cyclohexane, 1,1'-(1,2-Dibromo-1,2-Ethanediyl)Bis(3,4-Dibromo- |
| Molecular Structure | ![CAS#: 18122-77-5, 1,1'-(1,2-Dibromoethane-1,2-Diyl)Bis[3,4-Dibromocyclohexane]](/moreStructures/18122-77-5.gif) |
| Molecular Formula | C14H20Br6 |
| Molecular Weight | 667.74 |
| CAS Registry Number | 18122-77-5 |
| EINECS | 242-012-0 |
| SMILES | C1C(Br)C(Br)CCC1C(Br)C(Br)C2CC(Br)C(Br)CC2 |
| InChI | 1S/C14H20Br6/c15-9-3-1-7(5-11(9)17)13(19)14(20)8-2-4-10(16)12(18)6-8/h7-14H,1-6H2 |
| InChIKey | YBYGCIBLVFGTOD-UHFFFAOYSA-N |
| Density | 2.179g/cm3 (Cal.) |
|---|---|
| Boiling point | 536.269°C at 760 mmHg (Cal.) |
| Flash point | 267.096°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(1,2-Dibromoethane-1,2-Diyl)Bis[3,4-Dibromocyclohexane] |