|
CAS#: 1813-29-2 Product: Trifluoroacetic Acid p-Tolyl Ester No suppilers available for the product. |
| Name | Trifluoroacetic Acid p-Tolyl Ester |
|---|---|
| Synonyms | 2,2,2-Trifluoroacetic Acid (4-Methylphenyl) Ester; (4-Methylphenyl) 2,2,2-Trifluoroethanoate; P-Tolyl Trifluoroacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.15 |
| CAS Registry Number | 1813-29-2 |
| SMILES | C1=C(OC(C(F)(F)F)=O)C=CC(=C1)C |
| InChI | 1S/C9H7F3O2/c1-6-2-4-7(5-3-6)14-8(13)9(10,11)12/h2-5H,1H3 |
| InChIKey | HGHGGPKMLBWNBI-UHFFFAOYSA-N |
| Density | 1.278g/cm3 (Cal.) |
|---|---|
| Boiling point | 164.706°C at 760 mmHg (Cal.) |
| Flash point | 33.579°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Trifluoroacetic Acid p-Tolyl Ester |