|
CAS#: 18146-12-8 Product: (E)-1,2-Ethenediylbis[Chloro(Dimethyl)Silane] No suppilers available for the product. |
| Name | (E)-1,2-Ethenediylbis[Chloro(Dimethyl)Silane] |
|---|---|
| Synonyms | Chloro((E)-2-[chloro(dimethyl)silyl]ethenyl)dimethylsilane # |
| Molecular Structure | ![]() |
| Molecular Formula | C6H14Cl2Si2 |
| Molecular Weight | 213.25 |
| CAS Registry Number | 18146-12-8 |
| SMILES | Cl[Si](/C=C/[Si](Cl)(C)C)(C)C |
| InChI | 1S/C6H14Cl2Si2/c1-9(2,7)5-6-10(3,4)8/h5-6H,1-4H3/b6-5+ |
| InChIKey | QPSZLJMVINIQNU-AATRIKPKSA-N |
| Density | 0.99g/cm3 (Cal.) |
|---|---|
| Boiling point | 181.919°C at 760 mmHg (Cal.) |
| Flash point | 56.631°C (Cal.) |
| Refractive index | 1.442 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-1,2-Ethenediylbis[Chloro(Dimethyl)Silane] |