| Name | 2-(2-Phenylpropan-2-Yl)Phenol |
|---|---|
| Synonyms | 2-(1-Methyl-1-Phenyl-Ethyl)Phenol; 2-(1-Methyl-1-Phenylethyl)Phenol; Phenol, 2-(1-Methyl-1-Phenylethyl)- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 |
| CAS Registry Number | 18168-40-6 |
| SMILES | C1=C(C(=CC=C1)O)C(C)(C)C2=CC=CC=C2 |
| InChI | 1S/C15H16O/c1-15(2,12-8-4-3-5-9-12)13-10-6-7-11-14(13)16/h3-11,16H,1-2H3 |
| InChIKey | CJWNFAKWHDOUKL-UHFFFAOYSA-N |
| Density | 1.055g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.04°C at 760 mmHg (Cal.) |
| Flash point | 151.063°C (Cal.) |
| (1) | S. Ardizzone, G. Cappelletti, D. Meroni and F. Spadavecchia. Tailored TiO2 layers for the photocatalytic ozonation of cumylphenol, a refractory pollutant exerting hormonal activity, Chem. Commun., 2011, 47, 2640. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(2-Phenylpropan-2-Yl)Phenol |