|
CAS#: 1817-68-1 Product: 2,6-Bis(1-Phenylethyl)-P-Cresol No suppilers available for the product. |
| Name | 2,6-Bis(1-Phenylethyl)-P-Cresol |
|---|---|
| Synonyms | 2,6-Bis(1-Phenylethyl)-4-Methylphenol; 2,6-Bis(1-Phenylethyl)-P-Cresol; Alkofen Mbp |
| Molecular Structure | ![]() |
| Molecular Formula | C23H24O |
| Molecular Weight | 316.44 |
| CAS Registry Number | 1817-68-1 |
| EINECS | 217-328-7 |
| SMILES | C1=CC=C(C=C1)C(C2=C(O)C(=CC(=C2)C)C(C3=CC=CC=C3)C)C |
| InChI | 1S/C23H24O/c1-16-14-21(17(2)19-10-6-4-7-11-19)23(24)22(15-16)18(3)20-12-8-5-9-13-20/h4-15,17-18,24H,1-3H3 |
| InChIKey | QFCGHEBLSUPGPF-UHFFFAOYSA-N |
| Density | 1.064g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.865°C at 760 mmHg (Cal.) |
| Flash point | 203.872°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Bis(1-Phenylethyl)-P-Cresol |