|
CAS#: 18186-49-7 Product: 16-Hydroxyestrone No suppilers available for the product. |
| Name | 16-Hydroxyestrone |
|---|---|
| Synonyms | Estra-1,3,5(10)-Trien-17-One, 3,16-Dihydroxy-; 16-Hydroxyestrone; 16Beta-Hydroxyestrone |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 |
| CAS Registry Number | 18186-49-7 |
| SMILES | [C@H]34[C@H]2[C@@H](C1=C(C=C(O)C=C1)CC2)CC[C@@]3(C(=O)C(C4)O)C |
| InChI | 1S/C18H22O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-16,19-20H,2,4,6-7,9H2,1H3/t13-,14-,15+,16?,18+/m1/s1 |
| InChIKey | WPOCIZJTELRQMF-DIQFNYNJSA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.175°C at 760 mmHg (Cal.) |
| Flash point | 266.162°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16-Hydroxyestrone |