|
CAS#: 18193-10-7 Product: 5,7-Dichloro-8-Quinolinol Benzoate (Ester) No suppilers available for the product. |
| Name | 5,7-Dichloro-8-Quinolinol Benzoate (Ester) |
|---|---|
| Synonyms | (5,7-Dichloro-8-Quinolyl) Benzoate; Benzoic Acid (5,7-Dichloro-8-Quinolyl) Ester; 5,7-Dichloro-8-Benzoyloxyquinoline |
| Molecular Structure | ![]() |
| Molecular Formula | C16H9Cl2NO2 |
| Molecular Weight | 318.16 |
| CAS Registry Number | 18193-10-7 |
| SMILES | C1=CC=CC=C1C(=O)OC2=C(C=C(C3=C2N=CC=C3)Cl)Cl |
| InChI | 1S/C16H9Cl2NO2/c17-12-9-13(18)15(14-11(12)7-4-8-19-14)21-16(20)10-5-2-1-3-6-10/h1-9H |
| InChIKey | ULENYZCLSHUPHW-UHFFFAOYSA-N |
| Density | 1.42g/cm3 (Cal.) |
|---|---|
| Boiling point | 511.887°C at 760 mmHg (Cal.) |
| Flash point | 263.38°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7-Dichloro-8-Quinolinol Benzoate (Ester) |