|
CAS#: 18205-60-2 Product: 1-[(Z)-3-Cyclohexen-1-Ylidenemethyl]Pyrrolidine No suppilers available for the product. |
| Name | 1-[(Z)-3-Cyclohexen-1-Ylidenemethyl]Pyrrolidine |
|---|---|
| Synonyms | 1-[(Z)-3-Cyclohexen-1-ylidenemethyl]pyrrolidine # |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 |
| CAS Registry Number | 18205-60-2 |
| SMILES | C\2=C\CCC(=C\N1CCCC1)\C/2 |
| InChI | 1S/C11H17N/c1-2-6-11(7-3-1)10-12-8-4-5-9-12/h1-2,10H,3-9H2/b11-10+ |
| InChIKey | KIEOJVRTCDEYFN-ZHACJKMWSA-N |
| Density | 1.069g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.372°C at 760 mmHg (Cal.) |
| Flash point | 108.367°C (Cal.) |
| Refractive index | 1.618 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(Z)-3-Cyclohexen-1-Ylidenemethyl]Pyrrolidine |