|
CAS#: 18227-69-5 Product: 2-[3-(5,8-Dihydroxy-2-Isohexyl-2-Methyl-Chroman-6-Yl)-3-Oxo-Propyl]-1,4-Benzoquinone No suppilers available for the product. |
| Name | 2-[3-(5,8-Dihydroxy-2-Isohexyl-2-Methyl-Chroman-6-Yl)-3-Oxo-Propyl]-1,4-Benzoquinone |
|---|---|
| Synonyms | 2-[3-(5,8 |
| Molecular Structure | ![]() |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.50 |
| CAS Registry Number | 18227-69-5 |
| SMILES | CC(C)CCCC1(CCc2c(c(cc(c2O1)O)C(=O)CCC3=CC(=O)C=CC3=O)O)C |
| InChI | 1S/C25H30O6/c1-15(2)5-4-11-25(3)12-10-18-23(30)19(14-22(29)24(18)31-25)21(28)8-6-16-13-17(26)7-9-20(16)27/h7,9,13-15,29-30H,4-6,8,10-12H2,1-3H3 |
| InChIKey | CFUHXWZFOLVVDB-UHFFFAOYSA-N |
| Density | 1.203g/cm3 (Cal.) |
|---|---|
| Boiling point | 618.161°C at 760 mmHg (Cal.) |
| Flash point | 208.081°C (Cal.) |
| Refractive index | 1.568 (Cal.) |
| (1) | Cardillo G. Natural Chromenes—III , Colouring matters of wars: the structure of flemingins a, b, c and homoflemingin, Tetrahedron, 1968 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-[3-(5,8-Dihydroxy-2-Isohexyl-2-Methyl-Chroman-6-Yl)-3-Oxo-Propyl]-1,4-Benzoquinone |