Online Database of Chemicals from Around the World
| Name | 4-(1,2-Diphenylethenyl)Morpholine |
|---|---|
| Synonyms | 4-[1,2-Di(Phenyl)Ethenyl]Morpholine; 4-[(Z)-1,2-Di(Phenyl)Vinyl]Morpholine; 4-[1,2-Di(Phenyl)Vinyl]Morpholine |
| Molecular Structure |  |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.35 |
| CAS Registry Number | 18239-50-4 |
| SMILES | C1=CC=C(C=C1)\C=C(N2CCOCC2)\C3=CC=CC=C3 |
| InChI | 1S/C18H19NO/c1-3-7-16(8-4-1)15-18(17-9-5-2-6-10-17)19-11-13-20-14-12-19/h1-10,15H,11-14H2/b18-15- |
| InChIKey | MHIFCLKKYRCSOC-SDXDJHTJSA-N |
| Density | 1.119g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.362°C at 760 mmHg (Cal.) |
| Flash point | 121.36°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1,2-Diphenylethenyl)Morpholine |
