|
CAS#: 1824-88-0 Product: Methyl alpha-D-Glucofuranoside No suppilers available for the product. |
| Name | Methyl alpha-D-Glucofuranoside |
|---|---|
| Synonyms | (2R,3R,4R,5S)-2-[(1R)-1,2-Dihydroxyethyl]-5-Methoxy-Tetrahydrofuran-3,4-Diol; (2R,3R,4R,5S)-2-[(1R)-1,2-Dihydroxyethyl]-5-Methoxytetrahydrofuran-3,4-Diol; (2R,3R,4R,5S)-2-[(1R)-1,2-Dihydroxyethyl]-5-Methoxy-Oxolane-3,4-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C7H14O6 |
| Molecular Weight | 194.18 |
| CAS Registry Number | 1824-88-0 |
| SMILES | [C@@H]1(OC)[C@H](O)[C@@H](O)[C@H](O1)[C@H](O)CO |
| InChI | 1S/C7H14O6/c1-12-7-5(11)4(10)6(13-7)3(9)2-8/h3-11H,2H2,1H3/t3-,4-,5-,6-,7+/m1/s1 |
| InChIKey | ZSQBOIUCEISYSW-GKHCUFPYSA-N |
| Density | 1.472g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.814°C at 760 mmHg (Cal.) |
| Flash point | 222.815°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl alpha-D-Glucofuranoside |