|
CAS#: 182552-10-9 Product: Methyl N-[3-Methyl-1-(Methylamino)-1-Oxo-2-Butanyl]Tryptophanate No suppilers available for the product. |
| Name | Methyl N-[3-Methyl-1-(Methylamino)-1-Oxo-2-Butanyl]Tryptophanate |
|---|---|
| Synonyms | L-TRYPTOP |
| Molecular Structure | ![]() |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.41 |
| CAS Registry Number | 182552-10-9 |
| SMILES | CC(C)C(C(=O)NC)NC(Cc1c[nH]c2c1cccc2)C(=O)OC |
| InChI | 1S/C18H25N3O3/c1-11(2)16(17(22)19-3)21-15(18(23)24-4)9-12-10-20-14-8-6-5-7-13(12)14/h5-8,10-11,15-16,20-21H,9H2,1-4H3,(H,19,22) |
| InChIKey | QSMZBJYIJROLFF-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 560.2±50.0°C at 760 mmHg (Cal.) |
| Flash point | 292.6±30.1°C (Cal.) |
| Refractive index | 1.571 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl N-[3-Methyl-1-(Methylamino)-1-Oxo-2-Butanyl]Tryptophanate |