|
CAS#: 18264-97-6 Product: 3,7-Dinitro-9,10-Dihydro-2-Phenanthrenamine No suppilers available for the product. |
| Name | 3,7-Dinitro-9,10-Dihydro-2-Phenanthrenamine |
|---|---|
| Synonyms | 2-Phenanthrylamine, 9,10-dihydro-3,7-dinitro-; 3,7-Dinitro-9,10-dihydro-2-phenanthrenamine # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.25 |
| CAS Registry Number | 18264-97-6 |
| SMILES | [O-][N+](=O)c3ccc2c1c(cc(c([N+]([O-])=O)c1)N)CCc2c3 |
| InChI | 1S/C14H11N3O4/c15-13-6-9-2-1-8-5-10(16(18)19)3-4-11(8)12(9)7-14(13)17(20)21/h3-7H,1-2,15H2 |
| InChIKey | CPIKCNDCGKOEII-UHFFFAOYSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 537.015°C at 760 mmHg (Cal.) |
| Flash point | 278.577°C (Cal.) |
| Refractive index | 1.719 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7-Dinitro-9,10-Dihydro-2-Phenanthrenamine |