|
CAS#: 18266-28-9 Product: Strontium Bis(Dihydrogen Phosphate) No suppilers available for the product. |
| Name | Strontium Bis(Dihydrogen Phosphate) |
|---|---|
| Synonyms | Phosphoric Acid, Strontium Salt (2:1); Strontium Bis(Dihydrogen Phosphate); Strontium Monophosphate |
| Molecular Structure | ![]() |
| Molecular Formula | O8P2Sr |
| Molecular Weight | 277.56 |
| CAS Registry Number | 18266-28-9 |
| EINECS | 242-141-2 |
| SMILES | O=[P]([O-])([O-])[O-].O=[P]([O-])([O-])[O-].[Sr++] |
| InChI | 1S/2H3O4P.Sr/c2*1-5(2,3)4;/h2*(H3,1,2,3,4);/q;;+2/p-6 |
| InChIKey | AOKGFBICYSLGKE-UHFFFAOYSA-H |
| Boiling point | 158°C at 760 mmHg (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Strontium Bis(Dihydrogen Phosphate) |