Online Database of Chemicals from Around the World
|
CAS#: 18277-96-8 Product: (E)-1-(4-Bromo-2-Methoxyphenyl)-2-Phenyldiazene No suppilers available for the product. |
| Name | (E)-1-(4-Bromo-2-Methoxyphenyl)-2-Phenyldiazene |
|---|---|
| Synonyms | (E)-1-(4-Bromo-2-methoxyphenyl)-2-phenyldiazene # |
| Molecular Structure |  |
| Molecular Formula | C13H11BrN2O |
| Molecular Weight | 291.14 |
| CAS Registry Number | 18277-96-8 |
| SMILES | Brc2cc(OC)c(/N=N/c1ccccc1)cc2 |
| InChI | 1S/C13H11BrN2O/c1-17-13-9-10(14)7-8-12(13)16-15-11-5-3-2-4-6-11/h2-9H,1H3/b16-15+ |
| InChIKey | PVGKVQHQXSIQRN-FOCLMDBBSA-N |
| Density | 1.37g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.258°C at 760 mmHg (Cal.) |
| Flash point | 194.055°C (Cal.) |
| Refractive index | 1.595 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-1-(4-Bromo-2-Methoxyphenyl)-2-Phenyldiazene |