|
CAS#: 1828-09-7 Product: 4,4'-Difluorodiphenyliodonium Chloride No suppilers available for the product. |
| Name | 4,4'-Difluorodiphenyliodonium Chloride |
|---|---|
| Synonyms | Bis(4-Fluorophenyl)Iodonium Chloride; Ai3-17463; Bis(P-Fluorophenyl)Iodonium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8ClF2I |
| Molecular Weight | 352.55 |
| CAS Registry Number | 1828-09-7 |
| EINECS | 217-376-9 |
| SMILES | C1=CC(=CC=C1[I+]C2=CC=C(C=C2)F)F.[Cl-] |
| InChI | 1S/C12H8F2I.ClH/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;/h1-8H;1H/q+1;/p-1 |
| InChIKey | SZOHSFVTEGLKML-UHFFFAOYSA-M |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4'-Difluorodiphenyliodonium Chloride |