|
CAS#: 18300-04-4 Product: 1,2-Dibromo-4,5,6,7,8,8-Hexachloro-2,3,3a,4,7,7a-Hexahydro-4,7-Methano-1H-Indene No suppilers available for the product. |
| Name | 1,2-Dibromo-4,5,6,7,8,8-Hexachloro-2,3,3a,4,7,7a-Hexahydro-4,7-Methano-1H-Indene |
|---|---|
| Synonyms | 4,7-Methano-1H-Indene, 1,2-Dibromo-4,5,6,7,8,8-Hexachloro-2,3,3A, 4,7,7A-Hexahydro-; 4,7-Methano-1H-Indene, 1,2-Dibromo-4,5,6,7,8,8-Hexachloro-2,3,3A,4,7,7A-Hexahydro-; Ai3-15156 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6Br2Cl6 |
| Molecular Weight | 498.68 |
| CAS Registry Number | 18300-04-4 |
| EINECS | 242-183-1 |
| SMILES | C1C(C(Br)C2C1C3(Cl)C(=C(C2(Cl)C3(Cl)Cl)Cl)Cl)Br |
| InChI | 1S/C10H6Br2Cl6/c11-3-1-2-4(5(3)12)9(16)7(14)6(13)8(2,15)10(9,17)18/h2-5H,1H2 |
| InChIKey | RVVRZNVGDRBUJH-UHFFFAOYSA-N |
| Density | 2.166g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.027°C at 760 mmHg (Cal.) |
| Flash point | 249.735°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dibromo-4,5,6,7,8,8-Hexachloro-2,3,3a,4,7,7a-Hexahydro-4,7-Methano-1H-Indene |