Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054//+86 13424336463 | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,5-Bis(Cyanoamino)Benzoic Acid |
|---|---|
| Synonyms | 3,5-Bis-cyanoamino-benzoic acid; 3,5-dicyanamidobenzoic acid |
| Molecular Structure |  |
| Molecular Formula | C9H6N4O2 |
| Molecular Weight | 202.17 |
| CAS Registry Number | 183430-49-1 |
| SMILES | C1=C(C=C(C=C1NC#N)NC#N)C(=O)O |
| InChI | 1S/C9H6N4O2/c10-4-12-7-1-6(9(14)15)2-8(3-7)13-5-11/h1-3,12-13H,(H,14,15) |
| InChIKey | SVPVVJCSELVSTL-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.3±52.0°C at 760 mmHg (Cal.) |
| Flash point | 190.5±30.7°C (Cal.) |
| Refractive index | 1.754 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Bis(Cyanoamino)Benzoic Acid |