|
CAS#: 18354-27-3 Product: 3,5-Diisopropyl-2,6-Dimethylbenzoic Acid No suppilers available for the product. |
| Name | 3,5-Diisopropyl-2,6-Dimethylbenzoic Acid |
|---|---|
| Synonyms | 3,5-Diisopropyl-2,6-Dimethyl-Benzoic Acid; 3,5-Diisopropyl-2,6-Dimethylbenzoic Acid; Benzoic Acid, 3,5-Diisopropyl-2,6-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 |
| CAS Registry Number | 18354-27-3 |
| SMILES | C1=C(C(=C(C(=C1C(C)C)C)C(O)=O)C)C(C)C |
| InChI | 1S/C15H22O2/c1-8(2)12-7-13(9(3)4)11(6)14(10(12)5)15(16)17/h7-9H,1-6H3,(H,16,17) |
| InChIKey | CKZVJRAHZOBJTJ-UHFFFAOYSA-N |
| Density | 0.999g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.344°C at 760 mmHg (Cal.) |
| Flash point | 162.875°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Diisopropyl-2,6-Dimethylbenzoic Acid |