|
CAS#: 18395-80-7 Product: Di-Tert-Butoxydichlorosilane No suppilers available for the product. |
| Name | Di-Tert-Butoxydichlorosilane |
|---|---|
| Synonyms | Ditert-Butoxy-Dichloro-Silane; Ditert-Butoxy-Dichlorosilane; Di-Tert-Butoxydichlorosilane |
| Molecular Structure | ![]() |
| Molecular Formula | C8H18Cl2O2Si |
| Molecular Weight | 245.22 |
| CAS Registry Number | 18395-80-7 |
| SMILES | CC(O[Si](Cl)(Cl)OC(C)(C)C)(C)C |
| InChI | 1S/C8H18Cl2O2Si/c1-7(2,3)11-13(9,10)12-8(4,5)6/h1-6H3 |
| InChIKey | DLHSCEYJQODJPQ-UHFFFAOYSA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 204.458°C at 760 mmHg (Cal.) |
| Flash point | 65.796°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Di-Tert-Butoxydichlorosilane |