|
CAS#: 18431-51-1 Product: N(alpha)-Guanilhistamine No suppilers available for the product. |
| Name | N(alpha)-Guanilhistamine |
|---|---|
| Synonyms | Diaminomethylene-[2-(3H-Imidazol-4-Yl)Ethyl]Ammonium; C07454; N-Guanylhistamine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12N5 |
| Molecular Weight | 154.19 |
| CAS Registry Number | 18431-51-1 |
| SMILES | C1=C([NH]C=N1)CCNC(=[NH2+])N |
| InChI | 1S/C6H11N5/c7-6(8)10-2-1-5-3-9-4-11-5/h3-4H,1-2H2,(H,9,11)(H4,7,8,10)/p+1 |
| InChIKey | SDMTWUOOTPJPAH-UHFFFAOYSA-O |
| Boiling point | 467.046°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 236.261°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N(alpha)-Guanilhistamine |