|
CAS#: 18457-34-6 Product: 5,5'-Diisopropenyl-2,2'-Dimethyl-1,1'-Bi(Cyclohexyl)-3,3'-Dione No suppilers available for the product. |
| Name | 5,5'-Diisopropenyl-2,2'-Dimethyl-1,1'-Bi(Cyclohexyl)-3,3'-Dione |
|---|---|
| Synonyms | [1,1'-Bic |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.45 |
| CAS Registry Number | 18457-34-6 |
| SMILES | O=C1C(C(CC(\C(=C)C)C1)C2C(C(=O)CC(\C(=C)C)C2)C)C |
| InChI | 1S/C20H30O2/c1-11(2)15-7-17(13(5)19(21)9-15)18-8-16(12(3)4)10-20(22)14(18)6/h13-18H,1,3,7-10H2,2,4-6H3 |
| InChIKey | GVMQRYCIHSDNRX-UHFFFAOYSA-N |
| Density | 0.974g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.818°C at 760 mmHg (Cal.) |
| Flash point | 156.987°C (Cal.) |
| Refractive index | 1.49 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5'-Diisopropenyl-2,2'-Dimethyl-1,1'-Bi(Cyclohexyl)-3,3'-Dione |