|
CAS#: 18463-90-6 Product: 6-Dimethylaminophenylazobenzthiazole No suppilers available for the product. |
| Name | 6-Dimethylaminophenylazobenzthiazole |
|---|---|
| Synonyms | 4-(1,3-Benzothiazol-5-Ylazo)-N,N-Dimethyl-Aniline; 4-(1,3-Benzothiazol-5-Ylazo)-N,N-Dimethylaniline; [4-(1,3-Benzothiazol-5-Ylazo)Phenyl]-Dimethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.36 |
| CAS Registry Number | 18463-90-6 |
| SMILES | C1=C(C=CC2=C1N=CS2)N=NC3=CC=C(C=C3)N(C)C |
| InChI | 1S/C15H14N4S/c1-19(2)13-6-3-11(4-7-13)17-18-12-5-8-15-14(9-12)16-10-20-15/h3-10H,1-2H3 |
| InChIKey | SOORJESFYFAVOE-UHFFFAOYSA-N |
| Density | 1.248g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.592°C at 760 mmHg (Cal.) |
| Flash point | 236.591°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Dimethylaminophenylazobenzthiazole |