|
CAS#: 18511-00-7 Product: 5-Benzylidene-2-Phenyl-1,5-Dihydro-4H-Imidazol-4-One No suppilers available for the product. |
| Name | 5-Benzylidene-2-Phenyl-1,5-Dihydro-4H-Imidazol-4-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.28 |
| CAS Registry Number | 18511-00-7 |
| SMILES | O=C2/N=C(\NC2=Cc1ccccc1)c3ccccc3 |
| InChI | 1S/C16H12N2O/c19-16-14(11-12-7-3-1-4-8-12)17-15(18-16)13-9-5-2-6-10-13/h1-11H,(H,17,18,19) |
| InChIKey | KAWZYGYMVASGLF-UHFFFAOYSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.338°C at 760 mmHg (Cal.) |
| Flash point | 197.732°C (Cal.) |
| Refractive index | 1.634 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Benzylidene-2-Phenyl-1,5-Dihydro-4H-Imidazol-4-One |