| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Naphthalene-1,3,6,8-Tetrol |
|---|---|
| Synonyms | 1,3,6,8-Naphthalenetetrol; 1,3,6,8-Tetrahydroxynaphthalene; C04033 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 |
| CAS Registry Number | 18512-30-6 |
| SMILES | C1=C(C2=C(C=C1O)C=C(C=C2O)O)O |
| InChI | 1S/C10H8O4/c11-6-1-5-2-7(12)4-9(14)10(5)8(13)3-6/h1-4,11-14H |
| InChIKey | BCMKHWMDTMUUSI-UHFFFAOYSA-N |
| Density | 1.639g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.093°C at 760 mmHg (Cal.) |
| Flash point | 208.894°C (Cal.) |
| (1) | Ikuro Abe and Hiroyuki Morita. Structure and function of the chalcone synthase superfamily of plant type III polyketide synthases, Nat. Prod. Rep., 2010, 27, 809. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Naphthalene-1,3,6,8-Tetrol |