Online Database of Chemicals from Around the World
|
CAS#: 18527-35-0 Product: 5-[(3-Chlorophenylthio)Methyl]-1H-Tetrazole No suppilers available for the product. |
| Name | 5-[(3-Chlorophenylthio)Methyl]-1H-Tetrazole |
|---|---|
| Synonyms | 5-[[(3-Chlorophenyl)Thio]Methyl]-2H-Tetrazole; 5-[(3-Chlorophenyl)Sulfanylmethyl]-2H-1,2,3,4-Tetrazole; 5-(3-Chlorophenylthiomethyl)Tetrazole |
| Molecular Structure | ![CAS#: 18527-35-0, 5-[(3-Chlorophenylthio)Methyl]-1H-Tetrazole](/moreStructures/18527-35-0.gif) |
| Molecular Formula | C8H7ClN4S |
| Molecular Weight | 226.68 |
| CAS Registry Number | 18527-35-0 |
| SMILES | C2=CC=C(SCC1=N[NH]N=N1)C=C2Cl |
| InChI | 1S/C8H7ClN4S/c9-6-2-1-3-7(4-6)14-5-8-10-12-13-11-8/h1-4H,5H2,(H,10,11,12,13) |
| InChIKey | QXHAUJZTOFQRPP-UHFFFAOYSA-N |
| Density | 1.508g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.016°C at 760 mmHg (Cal.) |
| Flash point | 199.956°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[(3-Chlorophenylthio)Methyl]-1H-Tetrazole |