|
CAS#: 185429-83-8 Product: 1-[(1R,2S)-1,2,8,8-Tetramethyl-1,2,3,4,5,6,7,8-Octahydro-2-Naphthalenyl]Ethanone No suppilers available for the product. |
| Name | 1-[(1R,2S)-1,2,8,8-Tetramethyl-1,2,3,4,5,6,7,8-Octahydro-2-Naphthalenyl]Ethanone |
|---|---|
| Synonyms | Ethanone, |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 |
| CAS Registry Number | 185429-83-8 |
| SMILES | O=C([C@]1(CC/C2=C(\[C@H]1C)C(CCC2)(C)C)C)C |
| InChI | 1S/C16H26O/c1-11-14-13(7-6-9-15(14,3)4)8-10-16(11,5)12(2)17/h11H,6-10H2,1-5H3/t11-,16+/m1/s1 |
| InChIKey | YQYKESUTYHZAGG-BZNIZROVSA-N |
| Density | 0.951g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.161°C at 760 mmHg (Cal.) |
| Flash point | 127.665°C (Cal.) |
| Refractive index | 1.493 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(1R,2S)-1,2,8,8-Tetramethyl-1,2,3,4,5,6,7,8-Octahydro-2-Naphthalenyl]Ethanone |