|
CAS#: 1856-34-4 Product: Clotioxone No suppilers available for the product. |
| Name | Clotioxone |
|---|---|
| Synonyms | 5-Phenyl-3-(Trichloromethylthio)-1,3,4-Oxadiazol-2-One; 2-Phenyl-4-((Trichloromethyl)Thio-1,3,4-Oxadiazolin-5-One.; Clotioxone |
| Molecular Structure | ![]() |
| Molecular Formula | C9H5Cl3N2O2S |
| Molecular Weight | 311.57 |
| CAS Registry Number | 1856-34-4 |
| SMILES | C1=CC=CC=C1C2=NN(SC(Cl)(Cl)Cl)C(O2)=O |
| InChI | 1S/C9H5Cl3N2O2S/c10-9(11,12)17-14-8(15)16-7(13-14)6-4-2-1-3-5-6/h1-5H |
| InChIKey | AGNRWZQXNQBVQZ-UHFFFAOYSA-N |
| Density | 1.661g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.881°C at 760 mmHg (Cal.) |
| Flash point | 133.954°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Clotioxone |