|
CAS#: 1859-10-5 Product: 4-Methyl-9H-Fluoren-9-Ol No suppilers available for the product. |
| Name | 4-Methyl-9H-Fluoren-9-Ol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 |
| CAS Registry Number | 1859-10-5 |
| EINECS | 217-458-4 |
| SMILES | C1=C2C(=C(C=C1)C)C3=C(C2O)C=CC=C3 |
| InChI | 1S/C14H12O/c1-9-5-4-8-12-13(9)10-6-2-3-7-11(10)14(12)15/h2-8,14-15H,1H3 |
| InChIKey | XYFPAZQJSNRUSG-UHFFFAOYSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.741°C at 760 mmHg (Cal.) |
| Flash point | 138.408°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-9H-Fluoren-9-Ol |