|
CAS#: 18604-34-7 Product: 1,2-O-(1-Methylethylidene)-alpha-L-Sorbopyranose No suppilers available for the product. |
| Name | 1,2-O-(1-Methylethylidene)-alpha-L-Sorbopyranose |
|---|---|
| Synonyms | Alpha-L-Sorbopyranose, 1,2-O-(1-Methylethylidene)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 |
| CAS Registry Number | 18604-34-7 |
| EINECS | 242-445-5 |
| SMILES | [C@H]1([C@H]([C@@H]([C@@]2(OC1)OC(OC2)(C)C)O)O)O |
| InChI | 1S/C9H16O6/c1-8(2)14-4-9(15-8)7(12)6(11)5(10)3-13-9/h5-7,10-12H,3-4H2,1-2H3/t5-,6+,7-,9-/m0/s1 |
| InChIKey | NCPKAWHTYZABFG-XQXXSGGOSA-N |
| Density | 1.428g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.952°C at 760 mmHg (Cal.) |
| Flash point | 186.008°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-O-(1-Methylethylidene)-alpha-L-Sorbopyranose |