Online Database of Chemicals from Around the World
|
CAS#: 18636-32-3 Product: 3,7,8,10-Tetramethyl-Benzo[g]Pteridine-2,4(3H,10H)-Dione No suppilers available for the product. |
| Name | 3,7,8,10-Tetramethyl-Benzo[g]Pteridine-2,4(3H,10H)-Dione |
|---|---|
| Synonyms | 3,7,8,10-Tetramethylbenzo[G]Pteridine-2,4-Quinone; Isoalloxazine, 3,7,8,10-Tetramethyl-; 3-Methyllumiflavin |
| Molecular Structure | ![CAS#: 18636-32-3, 3,7,8,10-Tetramethyl-Benzo[g]Pteridine-2,4(3H,10H)-Dione](/moreStructures/18636-32-3.gif) |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 |
| CAS Registry Number | 18636-32-3 |
| SMILES | C1=C3C(=CC(=C1C)C)N(C2=NC(N(C(C2=N3)=O)C)=O)C |
| InChI | 1S/C14H14N4O2/c1-7-5-9-10(6-8(7)2)17(3)12-11(15-9)13(19)18(4)14(20)16-12/h5-6H,1-4H3 |
| InChIKey | DSUJCACXEBHAAS-UHFFFAOYSA-N |
| Density | 1.389g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.676°C at 760 mmHg (Cal.) |
| Flash point | 220.313°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7,8,10-Tetramethyl-Benzo[g]Pteridine-2,4(3H,10H)-Dione |