|
CAS#: 18648-77-6 Product: 2-Ethyl-4,4-Diphenyl-1,3-Oxathiolan-5-One No suppilers available for the product. |
| Name | 2-Ethyl-4,4-Diphenyl-1,3-Oxathiolan-5-One |
|---|---|
| Synonyms | 2-Ethyl-4,4-diphenyl-1,3-oxathiolan-5-one # |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16O2S |
| Molecular Weight | 284.37 |
| CAS Registry Number | 18648-77-6 |
| SMILES | O=C2OC(SC2(c1ccccc1)c3ccccc3)CC |
| InChI | 1S/C17H16O2S/c1-2-15-19-16(18)17(20-15,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15H,2H2,1H3 |
| InChIKey | PYWKSGVHAJEYMA-UHFFFAOYSA-N |
| Density | 1.184g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.169°C at 760 mmHg (Cal.) |
| Flash point | 236.623°C (Cal.) |
| Refractive index | 1.597 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-4,4-Diphenyl-1,3-Oxathiolan-5-One |