|
CAS#: 18678-65-4 Product: Isocyanato-Triphenyl-Silane No suppilers available for the product. |
| Name | Isocyanato-Triphenyl-Silane |
|---|---|
| Synonyms | Nsc331764 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H15NOSi |
| Molecular Weight | 301.42 |
| CAS Registry Number | 18678-65-4 |
| SMILES | O=C=N[Si](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C19H15NOSi/c21-16-20-22(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H |
| InChIKey | JNFUJVWWFWBAFI-UHFFFAOYSA-N |
| Density | 1.025g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.566°C at 760 mmHg (Cal.) |
| Flash point | 196.055°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Isocyanato-Triphenyl-Silane |