|
CAS#: 18690-80-7 Product: 2-(Butylamino)-3-Methyl-1,4-Naphthoquinone No suppilers available for the product. |
| Name | 2-(Butylamino)-3-Methyl-1,4-Naphthoquinone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.30 |
| CAS Registry Number | 18690-80-7 |
| SMILES | O=C\2c1c(cccc1)C(=O)C(=C/2C)/NCCCC |
| InChI | 1S/C15H17NO2/c1-3-4-9-16-13-10(2)14(17)11-7-5-6-8-12(11)15(13)18/h5-8,16H,3-4,9H2,1-2H3 |
| InChIKey | NFFLYRHGZUIVAE-UHFFFAOYSA-N |
| Density | 1.14g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.095°C at 760 mmHg (Cal.) |
| Flash point | 143.848°C (Cal.) |
| Refractive index | 1.567 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Butylamino)-3-Methyl-1,4-Naphthoquinone |