|
CAS#: 18711-18-7 Product: 5,6-Dichloro-3-(Hydroxyamino)-2H-Indol-2-One No suppilers available for the product. |
| Name | 5,6-Dichloro-3-(Hydroxyamino)-2H-Indol-2-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H4Cl2N2O2 |
| Molecular Weight | 231.04 |
| CAS Registry Number | 18711-18-7 |
| SMILES | Cl/C/2=C/C=1\C(=N/C(=O)C=1NO)\C=C\2\Cl |
| InChI | 1S/C8H4Cl2N2O2/c9-4-1-3-6(2-5(4)10)11-8(13)7(3)12-14/h1-2,14H,(H,11,12,13) |
| InChIKey | XFKKWKWZFPDVGL-UHFFFAOYSA-N |
| Density | 1.82g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.08°C at 760 mmHg (Cal.) |
| Flash point | 124.398°C (Cal.) |
| Refractive index | 1.742 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dichloro-3-(Hydroxyamino)-2H-Indol-2-One |