Online Database of Chemicals from Around the World
|
CAS#: 18720-11-1 Product: 1,1',1''-(1,3-Butadien-1-Yl-4-Ylidene)Trisbenzene No suppilers available for the product. |
| Name | 1,1',1''-(1,3-Butadien-1-Yl-4-Ylidene)Trisbenzene |
|---|---|
| Synonyms | [(3E)-1,4-Di(Phenyl)Buta-1,3-Dienyl]Benzene; Nsc96931; 1,1',1''-(1,3-Butadien-1-Yl-4-Ylidene)Trisbenzene |
| Molecular Structure |  |
| Molecular Formula | C22H18 |
| Molecular Weight | 282.38 |
| CAS Registry Number | 18720-11-1 |
| EINECS | 242-529-1 |
| SMILES | C3=C(C(=C\C=C\C1=CC=CC=C1)C2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C22H18/c1-4-11-19(12-5-1)13-10-18-22(20-14-6-2-7-15-20)21-16-8-3-9-17-21/h1-18H/b13-10+ |
| InChIKey | ZXJYAYKVSJJDNO-JLHYYAGUSA-N |
| Density | 1.063g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.061°C at 760 mmHg (Cal.) |
| Flash point | 230.509°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1',1''-(1,3-Butadien-1-Yl-4-Ylidene)Trisbenzene |