Online Database of Chemicals from Around the World
|
CAS#: 18735-47-2 Product: 2,5-Dimethyl-3,6-Diaziridinyl-1,4-Benzoquinone No suppilers available for the product. |
| Name | 2,5-Dimethyl-3,6-Diaziridinyl-1,4-Benzoquinone |
|---|---|
| Synonyms | 2,5-Bis(Aziridin-1-Yl)-3,6-Dimethyl-1,4-Benzoquinone; 2,5-Bis(1-Aziridinyl)-3,6-Dimethyl-1,4-Benzoquinone; 2,5-Diethylenimino-3,6-Dimethyl-P-Benzoquinone |
| Molecular Structure |  |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25 |
| CAS Registry Number | 18735-47-2 |
| SMILES | CC3=C(N1CC1)C(=O)C(=C(N2CC2)C3=O)C |
| InChI | 1S/C12H14N2O2/c1-7-9(13-3-4-13)12(16)8(2)10(11(7)15)14-5-6-14/h3-6H2,1-2H3 |
| InChIKey | IWVCOLOPRNYONP-UHFFFAOYSA-N |
| Density | 1.418g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.368°C at 760 mmHg (Cal.) |
| Flash point | 158.281°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dimethyl-3,6-Diaziridinyl-1,4-Benzoquinone |