|
CAS#: 18753-19-0 Product: Dimethyl-Di-1-Naphthalenyl-Silane No suppilers available for the product. |
| Name | Dimethyl-Di-1-Naphthalenyl-Silane |
|---|---|
| Synonyms | Dimethyl-Bis(1-Naphthyl)Silane; Silane, Dimethyl-Di-1-Naphthalenyl-; Silane,Dimethyl-Di-1-Naphthalenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H20Si |
| Molecular Weight | 312.49 |
| CAS Registry Number | 18753-19-0 |
| SMILES | C1=CC=CC2=C1C(=CC=C2)[Si](C)(C)C3=C4C(=CC=C3)C=CC=C4 |
| InChI | 1S/C22H20Si/c1-23(2,21-15-7-11-17-9-3-5-13-19(17)21)22-16-8-12-18-10-4-6-14-20(18)22/h3-16H,1-2H3 |
| InChIKey | SHCZBMYTPGCRGJ-UHFFFAOYSA-N |
| Density | 1.094g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.207°C at 760 mmHg (Cal.) |
| Flash point | 209.114°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl-Di-1-Naphthalenyl-Silane |