| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | (2beta,3alpha,5alpha)-21-Chloro-3-Hydroxy-2-(4-Morpholinyl)Pregnan-20-One |
|---|---|
| Synonyms | (2b,3a,5a |
| Molecular Structure | ![]() |
| Molecular Formula | C25H40ClNO3 |
| Molecular Weight | 438.04 |
| CAS Registry Number | 187652-71-7 |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(=O)CCl)CC[C@@H]4[C@@]3(C[C@@H]([C@H](C4)O)N5CCOCC5)C |
| InChI | 1S/C25H40ClNO3/c1-24-8-7-19-17(18(24)5-6-20(24)23(29)15-26)4-3-16-13-22(28)21(14-25(16,19)2)27-9-11-30-12-10-27/h16-22,28H,3-15H2,1-2H3/t16-,17-,18-,19-,20+,21-,22-,24-,25-/m0/s1 |
| InChIKey | NZFNABGZEQPYBX-PMBZPZLSSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 544.3±50.0°C at 760 mmHg (Cal.) |
| Flash point | 283.0±30.1°C (Cal.) |
| Refractive index | 1.546 (Cal.) |
| solubility | Soluble to 100 mM in 1eq. HCl and to 100 mM in DMSO |
| Market Analysis Reports |
| List of Reports Available for (2beta,3alpha,5alpha)-21-Chloro-3-Hydroxy-2-(4-Morpholinyl)Pregnan-20-One |